Perfume and beauty products ingredients
In stock
Sodium Lauryl Ether Sulphate (SLES) 70
Sodium laureth sulfate chemical formula is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate.
Its commercial product is heterogeneous in the number of ethoxyl groups, where n is the...
Group: Sodium lauryl sulfate

